Drugs present in MMsINC which are similar to the molecule MMscode: MMs00280350
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01724971 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.77 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.74 |
MMs01726068 | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.70 |
MMs01726069 | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.70 |