Drugs present in MMsINC which are similar to the molecule MMscode: MMs00274584
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.80 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.75 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.70 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.70 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.70 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |