Drugs present in MMsINC which are similar to the molecule MMscode: MMs00274374
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727136![]() | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.73 |
MMs01725013![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.72 |
MMs01725694![]() | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.72 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01725701![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |