Drugs present in MMsINC which are similar to the molecule MMscode: MMs00270602
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724819 | s1cccc1C(c1sccc1)=C1CCC[NH+](C1)C | 0.75 |
MMs01724818 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.75 |
MMs01727442 | s1cccc1C(c1sccc1)=C1CC(OC)C[N+](C1)(C)C | 0.75 |
MMs01724937 | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.73 |
MMs01724922 | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.73 |
MMs01725495 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.70 |
MMs01725497 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.70 |
MMs01725499 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.70 |
MMs01725501 | s1c2S(=O)(=O)C(CC(NCC)c2cc1S(=O)(=O)N)C | 0.70 |