Drugs present in MMsINC which are similar to the molecule MMscode: MMs00267694
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724933 | S(=O)(=O)(Nc1nc(nc(OC)c1)C)c1ccc(N)cc1 | 0.80 |
MMs01725047 | S(=O)(=O)(Nc1ncc(OC)cn1)c1ccc(N)cc1 | 0.77 |
MMs01724931 | S(=O)(=O)(Nc1ncnc(OC)c1OC)c1ccc(N)cc1 | 0.72 |
MMs01725089 | Clc1ccc(cc1)-c1c(nc(nc1N)N)CC | 0.72 |
MMs01724932 | S(=O)(=O)(NC(Nc1oc(C)c(n1)C)=N)c1ccc(N)cc1 | 0.71 |
MMs01724990 | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.70 |