Drugs present in MMsINC which are similar to the molecule MMscode: MMs00264069
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727061 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)C=CC2O | 0.74 |
MMs01727102 | O1C2C34C(C(N(CC3)CC=C)Cc3c4c1c(O)cc3)C=CC2O | 0.74 |
MMs01726500 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.72 |
MMs01726128 | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.71 |
MMs01726132 | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.71 |
MMs01726134 | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.71 |
MMs01726130 | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.71 |
MMs01727094 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2O)CC1CCC1 | 0.70 |
MMs01727096 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2O)CC1CCC1 | 0.70 |
MMs01727098 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=C)CC1CC1 | 0.70 |
MMs01727100 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=C)CC1CC1 | 0.70 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.70 |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.70 |