Drugs present in MMsINC which are similar to the molecule MMscode: MMs00256086
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.80 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725133 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.72 |
MMs01726473 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.72 |
MMs01724857 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.72 |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.71 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |