Drugs present in MMsINC which are similar to the molecule MMscode: MMs00231145
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725857 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.72 |
MMs01726462 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.72 |
MMs01725491 | Clc1cccc(Cl)c1-c1noc(C)c1C(=O)NC1C2SC(C)(C)C(N2C1=O)C(O)=O | 0.70 |
MMs01724724 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |
MMs01725708 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |