Drugs present in MMsINC which are similar to the molecule MMscode: MMs00193990
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725027 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01725208 | Clc1ccc(cc1)CC1=NN(C2CCCN(CC2)C)C(=O)c2c1cccc2 | 0.71 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.71 |
MMs01725579 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.70 |
MMs01725581 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.70 |