Drugs present in MMsINC which are similar to the molecule MMscode: MMs00185816
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726819 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.78 |
MMs01726820 | Clc1ccc(cc1)C(Oc1ccc(cc1)C(F)(F)F)C(OCCNC(=O)C)=O | 0.78 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.74 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.73 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.72 |