Drugs present in MMsINC which are similar to the molecule MMscode: MMs00150621
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.74 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.74 |
MMs01727610 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.70 |
MMs01727611 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.70 |
MMs01727612 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.70 |
MMs01727613 | ClCCN(CCCl)c1ccc(cc1)CC(OC1CCC2C3C(CCC12C)c1c(cc(OC(=O)Cc2ccc(N(CCCl)CCCl)cc2)cc1)CC3)=O | 0.70 |