Drugs present in MMsINC which are similar to the molecule MMscode: MMs00149372
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.77 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01725157![]() | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.72 |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.70 |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |