Drugs present in MMsINC which are similar to the molecule MMscode: MMs00127092
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725712![]() | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.74 |
MMs01727467![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.74 |
MMs01727466![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.74 |
MMs01727465![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.74 |
MMs01727464![]() | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.74 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.73 |
MMs01727042![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.73 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.73 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.73 |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.71 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.71 |
MMs01725483![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |