Drugs present in MMsINC which are similar to the molecule MMscode: MMs00104128
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.75 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.74 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.74 |
MMs01726847 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.73 |
MMs01726848 | Ic1c(N(C(=O)C)CC(C(O)=O)C)c(I)cc(I)c1N | 0.73 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01725932 | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.72 |
MMs01726073 | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.72 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.71 |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.71 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |