Drugs present in MMsINC which are similar to the molecule MMscode: MMs00098761
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.82 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.79 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.74 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.74 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.73 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01726110 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.72 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.71 |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.71 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.70 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.70 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.70 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.70 |