Drugs present in MMsINC which are similar to the molecule MMscode: MMs00093279
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.78 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.77 |
MMs01725055![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.77 |
MMs01725519![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.73 |
MMs01725521![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.73 |
MMs01725796![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01724792![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01725180![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCN(CC1)CCOC(=O)C | 0.70 |
MMs01725743![]() | S1c2c(N(c3c1cccc3)CC1C3CC[NH+](C1)CC3)cccc2 | 0.70 |