Drugs present in MMsINC which are similar to the molecule MMscode: MMs00086469
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.78 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.78 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.76 |
MMs01727243 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.76 |
MMs01725408 | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.75 |
MMs01725677 | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.71 |
MMs01727136 | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.70 |
MMs01725261 | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.70 |
MMs01725311 | S(=O)(=O)(NC(=O)c1cc(OC)c(cc1)Cc1c2cc(NC(OC3CCCC3)=O)ccc2n(c1)C)c1ccccc1C | 0.70 |