Drugs present in MMsINC which are similar to the molecule MMscode: MMs00077834
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.79 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.76 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.74 |
MMs01725329 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.74 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01724973 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.72 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.70 |
MMs01725306 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.70 |
MMs01724993 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.70 |