Drugs present in MMsINC which are similar to the molecule MMscode: MMs00070186
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.73 |
MMs01724735 | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.72 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |