Drugs present in MMsINC which are similar to the molecule MMscode: MMs00057871
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.76 |
MMs01724737 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.74 |
MMs01725786 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.74 |
MMs01724727 | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.73 |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.73 |