Drugs present in MMsINC which are similar to the molecule MMscode: MMs00056089
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.82 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.82 |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.78 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.78 |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.78 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.72 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.72 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.72 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.72 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.70 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.70 |