Drugs present in MMsINC which are similar to the molecule MMscode: MMs00054855
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725185 | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.76 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.76 |
MMs01726519 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.75 |
MMs01725392 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.75 |
MMs01726518 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.75 |
MMs01724743 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.75 |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.73 |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.71 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.70 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.70 |