Drugs present in MMsINC which are similar to the molecule MMscode: MMs00048966
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.81 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.74 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.72 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.72 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.72 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725581 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.71 |
MMs01725579 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.71 |