Drugs present in MMsINC which are similar to the molecule MMscode: MMs00047777
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.73 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.73 |