Drugs present in MMsINC which are similar to the molecule MMscode: MMs00032384
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.70 |
MMs01727289 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727291 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727293 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727295 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |