Drugs present in MMsINC which are similar to the molecule MMscode: MMs00026266
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.80 |
MMs01726823![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.75 |
MMs01726821![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.75 |
MMs01726825![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2N1C(=O)C(NC1(C)C)c1ccccc1 | 0.75 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01727455![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727449![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727451![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727453![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.70 |
MMs01725483![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |














