Drugs present in MMsINC which are similar to the molecule MMscode: MMs00025478
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725051![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.76 |
MMs01725053![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.76 |
MMs01725779![]() | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.73 |
MMs01725466![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01725468![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |