Drugs present in MMsINC which are similar to the molecule MMscode: MMs00018649
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.76 |
MMs01726730 | Clc1cc(N2CCN(CC2)CCCN2N=C(N(CC)C2=O)CC)ccc1 | 0.74 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.74 |
MMs01724959 | Clc1cccc(Cl)c1N(CC=C)C1=[NH+]CCN1 | 0.74 |
MMs01725291 | Clc1cccc(Cl)c1N=C1NCCN1 | 0.71 |
MMs01724941 | Clc1ccc2nsnc2c1NC1=[NH+]CCN1 | 0.70 |