Drugs present in MMsINC which are similar to the molecule MMscode: MMs00017252
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725977![]() | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01725979![]() | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01725981![]() | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01727245![]() | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727247![]() | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727249![]() | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727251![]() | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |









