Drugs present in MMsINC which are similar to the molecule MMscode: MMs00016778
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726865 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.79 |
MMs01726866 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.79 |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.79 |
MMs01727015 | Ic1c(C(O)=O)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.75 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.73 |
MMs01726878 | Ic1c(C(=O)NC)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.73 |
MMs01726880 | Ic1c(CCC(O)=O)c(I)cc(I)c1\N=C\N(C)C | 0.71 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.71 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.71 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.71 |