Drugs present in MMsINC which are similar to the molecule MMscode: MMs00009669
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.86 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.86 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.86 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.75 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.74 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.73 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.73 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |