Drugs present in MMsINC which are similar to the molecule MMscode: MMs00007757
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724886 | S=C(N)c1cc(ncc1)CC | 0.76 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.72 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.71 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.71 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |