Drugs present in MMsINC which are similar to the molecule MMscode: MMs00005971
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.84 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.84 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.79 |
MMs01725298 | [NH3+]C1CC1c1ccccc1 | 0.79 |
MMs01725649 | [NH3+]C1CC1c1ccccc1 | 0.79 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.74 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.73 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.71 |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |