Drugs present in MMsINC which are similar to the molecule MMscode: MMs00005933
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.76 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.74 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.74 |
MMs01726868![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726869![]() | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726870![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726871![]() | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726872![]() | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |