Drugs present in MMsINC which are similar to the molecule MMscode: MMs00001246
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725947 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.74 |
MMs01726922 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.74 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.72 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01725929 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01725244 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.71 |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.71 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.71 |