 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc2c([nH]cc2CCN/C(=N\C(=O)C(CC)C)/Nc2nc(cc(n2)C)C)cc1 |
| InChI: | InChI=1/C22H27ClN6O/c1-5-13(2)20(30)28-21(29-22-26-14(3)10-15(4)27-22)24-9-8-16-12-25-19-7-6-17(23)11-18(16)19/h6-7,10-13,25H,5,8-9H2,1-4H3,(H2,24,26,27,28,29,30)/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=29.4116 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.952 g/mol | logS: -5.82133 | SlogP: 4.40101 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0711568 | Sterimol/B1: 2.54606 | Sterimol/B2: 4.87917 | Sterimol/B3: 5.49111 | |||
| Sterimol/B4: 12.42 | Sterimol/L: 17.2776 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 740.045 | Positive charged surface: 459.799 | Negative charged surface: 275.4 | Volume: 410.25 | |||
| Hydrophobic surface: 579.91 | Hydrophilic surface: 160.135 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.