 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1CC2=CCC3C4C\C(=C\c5cnn(C)c5C)\C(=O)C4(CCC3C2(CC1)C)C |
| InChI: | InChI=1/C25H34N2O2/c1-15-17(14-26-27(15)4)11-16-12-22-20-6-5-18-13-19(28)7-9-24(18,2)21(20)8-10-25(22,3)23(16)29/h5,11,14,19-22,28H,6-10,12-13H2,1-4H3/b16-11-/t19-,20-,21-,22+,24+,25+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=153.627 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 394.559 g/mol | logS: -4.2359 | SlogP: 4.97382 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0680028 | Sterimol/B1: 2.67377 | Sterimol/B2: 3.58998 | Sterimol/B3: 4.33695 | |||
| Sterimol/B4: 6.07116 | Sterimol/L: 18.9548 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 639.857 | Positive charged surface: 468.315 | Negative charged surface: 171.542 | Volume: 402.25 | |||
| Hydrophobic surface: 512.437 | Hydrophilic surface: 127.42 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.