 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(N)C(O)C)C(=O)NC(C(=O)[O-])CO |
| InChI: | InChI=1/C16H23N3O7/c1-8(21)13(17)15(24)18-11(6-9-2-4-10(22)5-3-9)14(23)19-12(7-20)16(25)26/h2-5,8,11-13,20-22H,6-7,17H2,1H3,(H,18,24)(H,19,23)(H,25,26)/p-1/t8-,11+,12+,13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=74.9514 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 368.366 g/mol | logS: -1.27288 | SlogP: -3.64543 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.120902 | Sterimol/B1: 2.4956 | Sterimol/B2: 3.56536 | Sterimol/B3: 4.04491 | |||
| Sterimol/B4: 8.40111 | Sterimol/L: 15.5254 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 596.946 | Positive charged surface: 355.982 | Negative charged surface: 240.964 | Volume: 332.125 | |||
| Hydrophobic surface: 298.069 | Hydrophilic surface: 298.877 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
