 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(N)C(O)C)C(=O)NC(C(O)=O)CO |
| InChI: | InChI=1/C16H23N3O7/c1-8(21)13(17)15(24)18-11(6-9-2-4-10(22)5-3-9)14(23)19-12(7-20)16(25)26/h2-5,8,11-13,20-22H,6-7,17H2,1H3,(H,18,24)(H,19,23)(H,25,26)/t8-,11-,12-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=97.7991 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.374 g/mol | logS: -1.01243 | SlogP: -2.31073 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0940656 | Sterimol/B1: 2.91545 | Sterimol/B2: 3.09553 | Sterimol/B3: 4.38509 | |||
| Sterimol/B4: 9.07759 | Sterimol/L: 15.6102 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 619.258 | Positive charged surface: 403.165 | Negative charged surface: 216.093 | Volume: 333.875 | |||
| Hydrophobic surface: 280.089 | Hydrophilic surface: 339.169 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.