Type: Neutral
Formula: C13H18N2O4
SMILES: |
Oc1ccc(cc1)CC(NC(=O)C(N)CC)C(O)=O |
InChI: |
InChI=1/C13H18N2O4/c1-2-10(14)12(17)15-11(13(18)19)7-8-3-5-9(16)6-4-8/h3-6,10-11,16H,2,7,14H2,1H3,(H,15,17)(H,18,19)/t10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.297 g/mol | logS: -1.44671 | SlogP: 0.24137 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.119123 | Sterimol/B1: 2.60743 | Sterimol/B2: 3.51414 | Sterimol/B3: 4.47996 |
Sterimol/B4: 7.77574 | Sterimol/L: 13.284 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.074 | Positive charged surface: 315.876 | Negative charged surface: 184.198 | Volume: 254.875 |
Hydrophobic surface: 263.408 | Hydrophilic surface: 236.666 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |