 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)NC(Cc1ccccc1)C(=O)N |
| InChI: | InChI=1/C23H29N3O4/c1-3-16(2)20(26-23(29)30-15-18-12-8-5-9-13-18)22(28)25-19(21(24)27)14-17-10-6-4-7-11-17/h4-13,16,19-20H,3,14-15H2,1-2H3,(H2,24,27)(H,25,28)(H,26,29)/t16-,19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=82.605 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.502 g/mol | logS: -5.1343 | SlogP: 2.80667 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.115209 | Sterimol/B1: 2.23115 | Sterimol/B2: 3.83389 | Sterimol/B3: 5.40329 | |||
| Sterimol/B4: 10.7023 | Sterimol/L: 17.5943 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.925 | Positive charged surface: 437.85 | Negative charged surface: 277.075 | Volume: 405.5 | |||
| Hydrophobic surface: 527.641 | Hydrophilic surface: 187.284 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.