 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccccc1\C=N\C(CCCNC(\N=C\c1ccccc1O)=N)C(=O)[O-] |
| InChI: | InChI=1/C20H22N4O4/c21-20(24-13-15-7-2-4-10-18(15)26)22-11-5-8-16(19(27)28)23-12-14-6-1-3-9-17(14)25/h1-4,6-7,9-10,12-13,16,25-26H,5,8,11H2,(H2,21,22)(H,27,28)/p-1/b23-12+,24-13+/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=25.8475 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 381.412 g/mol | logS: -3.7462 | SlogP: 1.05887 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0609751 | Sterimol/B1: 3.08136 | Sterimol/B2: 3.58099 | Sterimol/B3: 4.23044 | |||
| Sterimol/B4: 8.86015 | Sterimol/L: 18.2878 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 686.406 | Positive charged surface: 401.225 | Negative charged surface: 285.181 | Volume: 361.375 | |||
| Hydrophobic surface: 453.502 | Hydrophilic surface: 232.904 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
