 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P1(OC2C(OC(N3C=CC(=NC3=O)N)C2O)CO1)(=O)[O-] |
| InChI: | InChI=1/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14)/p-1/t4-,6-,7-,8-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-6.26901 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 304.175 g/mol | logS: -0.62807 | SlogP: -2.8077 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.122735 | Sterimol/B1: 2.66631 | Sterimol/B2: 3.52877 | Sterimol/B3: 3.87327 | |||
| Sterimol/B4: 5.74676 | Sterimol/L: 13.851 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 446.474 | Positive charged surface: 241.418 | Negative charged surface: 205.055 | Volume: 225.5 | |||
| Hydrophobic surface: 144.416 | Hydrophilic surface: 302.058 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
