 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(OC(C(O)C(NC(=O)C)C=O)C(O)COS(=O)(=O)[O-])(=O)(=O)[O-] |
| InChI: | InChI=1/C8H15NO12S2/c1-4(11)9-5(2-10)7(13)8(21-23(17,18)19)6(12)3-20-22(14,15)16/h2,5-8,12-13H,3H2,1H3,(H,9,11)(H,14,15,16)(H,17,18,19)/p-2/t5-,6-,7-,8-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=1.16397 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 379.319 g/mol | logS: -0.0912 | SlogP: -4.266 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0884167 | Sterimol/B1: 2.69279 | Sterimol/B2: 4.18303 | Sterimol/B3: 5.02911 | |||
| Sterimol/B4: 6.64616 | Sterimol/L: 14.9463 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 535.545 | Positive charged surface: 206.026 | Negative charged surface: 329.519 | Volume: 261.625 | |||
| Hydrophobic surface: 155.373 | Hydrophilic surface: 380.172 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 6 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
