 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3N=Cn4c(ncc4)-c3nc2)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C12H14N5O7P/c18-8-6(3-23-25(20,21)22)24-12(9(8)19)17-5-14-7-10-13-1-2-16(10)4-15-11(7)17/h1-2,4-6,8-9,12,18-19H,3H2,(H2,20,21,22)/p-2/t6-,8+,9+,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=38.7547 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.23 g/mol | logS: -1.39899 | SlogP: -3.2421 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0665816 | Sterimol/B1: 2.52104 | Sterimol/B2: 2.99331 | Sterimol/B3: 4.10219 | |||
| Sterimol/B4: 5.40577 | Sterimol/L: 16.8639 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 510.498 | Positive charged surface: 293.718 | Negative charged surface: 216.78 | Volume: 277.75 | |||
| Hydrophobic surface: 226.968 | Hydrophilic surface: 283.53 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
