Type: Neutral
Formula: C9H17NO7
SMILES: |
O1C(CO)C(O)C(OC(C(O)=O)C)C(N)C1O |
InChI: |
InChI=1/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3-,4+,5+,6+,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 251.235 g/mol | logS: 0.68782 | SlogP: -2.7576 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.119273 | Sterimol/B1: 2.12558 | Sterimol/B2: 4.27203 | Sterimol/B3: 4.39425 |
Sterimol/B4: 4.74195 | Sterimol/L: 12.557 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 445.205 | Positive charged surface: 319.646 | Negative charged surface: 125.559 | Volume: 216.125 |
Hydrophobic surface: 151.47 | Hydrophilic surface: 293.735 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |