 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(NC(OC(C)(C)C)=O)Cc1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C23H28N2O6/c1-23(2,3)31-22(30)25-18(13-15-7-5-4-6-8-15)20(27)24-19(21(28)29)14-16-9-11-17(26)12-10-16/h4-12,18-19,26H,13-14H2,1-3H3,(H,24,27)(H,25,30)(H,28,29)/p-1/t18-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=63.6233 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 427.477 g/mol | logS: -4.54721 | SlogP: 1.30534 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.103244 | Sterimol/B1: 2.32547 | Sterimol/B2: 3.26629 | Sterimol/B3: 4.9991 | |||
| Sterimol/B4: 9.60612 | Sterimol/L: 14.2481 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 697.933 | Positive charged surface: 414.044 | Negative charged surface: 283.889 | Volume: 414 | |||
| Hydrophobic surface: 479.561 | Hydrophilic surface: 218.372 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
