 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCc1cnc(C)c(O)c1\C=N\C(CC(O)C)C(=O)[O-])(=O)([O-])[O-] |
| InChI: | InChI=1/C13H19N2O8P/c1-7(16)3-11(13(18)19)15-5-10-9(6-23-24(20,21)22)4-14-8(2)12(10)17/h4-5,7,11,16-17H,3,6H2,1-2H3,(H,18,19)(H2,20,21,22)/p-3/b15-5+/t7-,11-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=36.4084 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 359.251 g/mol | logS: -0.46343 | SlogP: -3.05458 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.117215 | Sterimol/B1: 2.05644 | Sterimol/B2: 4.40307 | Sterimol/B3: 4.72337 | |||
| Sterimol/B4: 9.59351 | Sterimol/L: 15.2159 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 565.047 | Positive charged surface: 285.104 | Negative charged surface: 279.943 | Volume: 291.75 | |||
| Hydrophobic surface: 271.669 | Hydrophilic surface: 293.378 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 5 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
