 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(C(=O)NCC2CCC(CC2)C(O)=O)C)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C19H23N3O5/c1-11(16(23)20-10-12-6-8-13(9-7-12)18(25)26)22-17(24)14-4-2-3-5-15(14)21-19(22)27/h2-5,11-13H,6-10H2,1H3,(H,20,23)(H,21,27)(H,25,26)/t11-,12-,13+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.545 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 373.409 g/mol | logS: -3.11626 | SlogP: 2.07 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0696708 | Sterimol/B1: 2.27845 | Sterimol/B2: 2.39359 | Sterimol/B3: 5.75561 | |||
| Sterimol/B4: 6.42894 | Sterimol/L: 18.3876 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 612.323 | Positive charged surface: 395.943 | Negative charged surface: 216.38 | Volume: 338.25 | |||
| Hydrophobic surface: 408.626 | Hydrophilic surface: 203.697 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
