 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(CC(C)C)C(=O)NC(CCC(=O)[O-])C(=O)[O-])C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C19H23N3O7/c1-10(2)9-14(16(25)20-13(18(27)28)7-8-15(23)24)22-17(26)11-5-3-4-6-12(11)21-19(22)29/h3-6,10,13-14H,7-9H2,1-2H3,(H,20,25)(H,21,29)(H,23,24)(H,27,28)/p-2/t13-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.5721 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 403.391 g/mol | logS: -4.16017 | SlogP: -1.1462 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.20877 | Sterimol/B1: 3.13033 | Sterimol/B2: 3.65931 | Sterimol/B3: 6.63315 | |||
| Sterimol/B4: 7.55832 | Sterimol/L: 16.4131 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 641.367 | Positive charged surface: 335.641 | Negative charged surface: 305.726 | Volume: 361.125 | |||
| Hydrophobic surface: 333.339 | Hydrophilic surface: 308.028 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
